C21H39N5O4 — CID 110034137
2-[[(1,4-dioxaspiro[4.5]decan-3-ylmethylamino)-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide (PubChem CID 110034137) has the molecular formula C21H39N5O4 and a molecular weight of 425.57 g/mol. Its IUPAC name is 2-[[(1,4-dioxaspiro[4.5]decan-3-ylmethylamino)-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide.
| Compound Name | 2-[[(1,4-dioxaspiro[4.5]decan-3-ylmethylamino)-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
|---|---|
| PubChem CID | 110034137 |
| Molecular Formula | C21H39N5O4 |
| Molecular Weight | 425.57 g/mol |
| Exact Mass | 425.30 |
| IUPAC Name | 2-[[(1,4-dioxaspiro[4.5]decan-3-ylmethylamino)-(3-morpholin-4-ylpropylamino)methylidene]amino]-N,N-dimethylacetamide |
| SMILES | CN(C)C(=O)C/N=C(\NCCCN1CCOCC1)NCC1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C21H39N5O4/c1-25(2)19(27)16-24-20(22-9-6-10-26-11-13-28-14-12-26)23-15-18-17-29-21(30-18)7-4-3-5-8-21/h18H,3-17H2,1-2H3,(H2,22,23,24) |
| InChIKey | XIRAMUNMDKQVMQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 87.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.57 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|