C17H29N3O5 — CID 7645739
N'-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide (PubChem CID 7645739) has the molecular formula C17H29N3O5 and a molecular weight of 355.44 g/mol. Its IUPAC name is N'-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide.
| Compound Name | N'-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 7645739 |
| Molecular Formula | C17H29N3O5 |
| Molecular Weight | 355.44 g/mol |
| Exact Mass | 355.21 |
| IUPAC Name | N'-[[(3R)-1,4-dioxaspiro[4.5]decan-3-yl]methyl]-N-(2-morpholin-4-ylethyl)oxamide |
| SMILES | O=C(NCCN1CCOCC1)C(=O)NC[C@@H]1COC2(CCCCC2)O1 |
| InChI | InChI=1S/C17H29N3O5/c21-15(18-6-7-20-8-10-23-11-9-20)16(22)19-12-14-13-24-17(25-14)4-2-1-3-5-17/h14H,1-13H2,(H,18,21)(H,19,22)/t14-/m1/s1 |
| InChIKey | RLFSJOHZLFKRGN-CQSZACIVSA-N |
| XLogP | -0.37 |
| TPSA | 89.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.44 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|