C15H27IN4O2 — CID 111354969
2-[[butylamino-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 111354969) has the molecular formula C15H27IN4O2 and a molecular weight of 422.31 g/mol. Its IUPAC name is 2-[[butylamino-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[butylamino-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 111354969 |
| Molecular Formula | C15H27IN4O2 |
| Molecular Weight | 422.31 g/mol |
| Exact Mass | 422.12 |
| IUPAC Name | 2-[[butylamino-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCCCN/C(=N\CC(=O)N(C)C)NCCc1ccco1.I |
| InChI | InChI=1S/C15H26N4O2.HI/c1-4-5-9-16-15(18-12-14(20)19(2)3)17-10-8-13-7-6-11-21-13;/h6-7,11H,4-5,8-10,12H2,1-3H3,(H2,16,17,18);1H |
| InChIKey | ZKUXHDXCBNNARE-UHFFFAOYSA-N |
| XLogP | 1.86 |
| TPSA | 69.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.31 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|