C21H31IN4O3 — CID 110052971
2-[[[2-(3-ethoxyphenyl)ethylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide (PubChem CID 110052971) has the molecular formula C21H31IN4O3 and a molecular weight of 514.41 g/mol. Its IUPAC name is 2-[[[2-(3-ethoxyphenyl)ethylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide.
| Compound Name | 2-[[[2-(3-ethoxyphenyl)ethylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
|---|---|
| PubChem CID | 110052971 |
| Molecular Formula | C21H31IN4O3 |
| Molecular Weight | 514.41 g/mol |
| Exact Mass | 514.14 |
| IUPAC Name | 2-[[[2-(3-ethoxyphenyl)ethylamino]-[2-(furan-2-yl)ethylamino]methylidene]amino]-N,N-dimethylacetamide;hydroiodide |
| SMILES | CCOc1cccc(CCN/C(=N/CC(=O)N(C)C)NCCc2ccco2)c1.I |
| InChI | InChI=1S/C21H30N4O3.HI/c1-4-27-19-8-5-7-17(15-19)10-12-22-21(24-16-20(26)25(2)3)23-13-11-18-9-6-14-28-18;/h5-9,14-15H,4,10-13,16H2,1-3H3,(H2,22,23,24);1H |
| InChIKey | XXIDZIVLNWWGDH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 79.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|