C18H34N4O3S — CID 110036177
N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(2-methylsulfanylethylamino)methylidene]amino]acetamide (PubChem CID 110036177) has the molecular formula C18H34N4O3S and a molecular weight of 386.56 g/mol. Its IUPAC name is N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(2-methylsulfanylethylamino)methylidene]amino]acetamide.
| Compound Name | N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(2-methylsulfanylethylamino)methylidene]amino]acetamide |
|---|---|
| PubChem CID | 110036177 |
| Molecular Formula | C18H34N4O3S |
| Molecular Weight | 386.56 g/mol |
| Exact Mass | 386.24 |
| IUPAC Name | N,N-dimethyl-2-[[[(8-methyl-1,4-dioxaspiro[4.5]decan-3-yl)methylamino]-(2-methylsulfanylethylamino)methylidene]amino]acetamide |
| SMILES | CSCCN/C(=N\CC(=O)N(C)C)NCC1COC2(CCC(C)CC2)O1 |
| InChI | InChI=1S/C18H34N4O3S/c1-14-5-7-18(8-6-14)24-13-15(25-18)11-20-17(19-9-10-26-4)21-12-16(23)22(2)3/h14-15H,5-13H2,1-4H3,(H2,19,20,21) |
| InChIKey | BZHFNDWGTGEMLW-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.56 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|