C10H17BrO3 — CID 10778065
(9S,10R)-10-bromo-9-methyl-7,8,12-trioxaspiro[5.6]dodecane (PubChem CID 10778065) has the molecular formula C10H17BrO3 and a molecular weight of 265.15 g/mol. Its IUPAC name is (9S,10R)-10-bromo-9-methyl-7,8,12-trioxaspiro[5.6]dodecane.
| Compound Name | (9S,10R)-10-bromo-9-methyl-7,8,12-trioxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 10778065 |
| Molecular Formula | C10H17BrO3 |
| Molecular Weight | 265.15 g/mol |
| Exact Mass | 264.04 |
| IUPAC Name | (9S,10R)-10-bromo-9-methyl-7,8,12-trioxaspiro[5.6]dodecane |
| SMILES | C[C@@H]1OOC2(CCCCC2)OC[C@H]1Br |
| InChI | InChI=1S/C10H17BrO3/c1-8-9(11)7-12-10(14-13-8)5-3-2-4-6-10/h8-9H,2-7H2,1H3/t8-,9+/m0/s1 |
| InChIKey | DZCHCBQHKUPQAE-DTWKUNHWSA-N |
| XLogP | 2.78 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.15 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|