C9H16O3 — CID 15040523
3-ethyl-1,2,4-trioxaspiro[4.5]decane (PubChem CID 15040523) has the molecular formula C9H16O3 and a molecular weight of 172.22 g/mol. Its IUPAC name is 3-ethyl-1,2,4-trioxaspiro[4.5]decane.
| Compound Name | 3-ethyl-1,2,4-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 15040523 |
| Molecular Formula | C9H16O3 |
| Molecular Weight | 172.22 g/mol |
| Exact Mass | 172.11 |
| IUPAC Name | 3-ethyl-1,2,4-trioxaspiro[4.5]decane |
| SMILES | CCC1OOC2(CCCCC2)O1 |
| InChI | InChI=1S/C9H16O3/c1-2-8-10-9(12-11-8)6-4-3-5-7-9/h8H,2-7H2,1H3 |
| InChIKey | FQQSAPXKXPHWSV-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.22 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|