C10H16O2 — CID 176555233
2-ethyl-3-methylidene-1,4-dioxaspiro[4.4]nonane (PubChem CID 176555233) has the molecular formula C10H16O2 and a molecular weight of 168.24 g/mol. Its IUPAC name is 2-ethyl-3-methylidene-1,4-dioxaspiro[4.4]nonane.
| Compound Name | 2-ethyl-3-methylidene-1,4-dioxaspiro[4.4]nonane |
|---|---|
| PubChem CID | 176555233 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 2-ethyl-3-methylidene-1,4-dioxaspiro[4.4]nonane |
| SMILES | C=C1OC2(CCCC2)OC1CC |
| InChI | InChI=1S/C10H16O2/c1-3-9-8(2)11-10(12-9)6-4-5-7-10/h9H,2-7H2,1H3 |
| InChIKey | SZXKSSWULMMFBY-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |