C13H21O6P — CID 134474644
2-dimethoxyphosphoryl-1-(9-methylidene-6,10-dioxaspiro[4.5]decan-7-yl)ethanone (PubChem CID 134474644) has the molecular formula C13H21O6P and a molecular weight of 304.28 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-1-(9-methylidene-6,10-dioxaspiro[4.5]decan-7-yl)ethanone.
| Compound Name | 2-dimethoxyphosphoryl-1-(9-methylidene-6,10-dioxaspiro[4.5]decan-7-yl)ethanone |
|---|---|
| PubChem CID | 134474644 |
| Molecular Formula | C13H21O6P |
| Molecular Weight | 304.28 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-dimethoxyphosphoryl-1-(9-methylidene-6,10-dioxaspiro[4.5]decan-7-yl)ethanone |
| SMILES | C=C1CC(C(=O)CP(=O)(OC)OC)OC2(CCCC2)O1 |
| InChI | InChI=1S/C13H21O6P/c1-10-8-12(11(14)9-20(15,16-2)17-3)19-13(18-10)6-4-5-7-13/h12H,1,4-9H2,2-3H3 |
| InChIKey | KMBBDGVJHBBUIF-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.28 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|