C10H19O4P — CID 71308990
2-dimethoxyphosphoryl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethanone (PubChem CID 71308990) has the molecular formula C10H19O4P and a molecular weight of 245.30 g/mol. Its IUPAC name is 2-dimethoxyphosphoryl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethanone.
| Compound Name | 2-dimethoxyphosphoryl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethanone |
|---|---|
| PubChem CID | 71308990 |
| Molecular Formula | C10H19O4P |
| Molecular Weight | 245.30 g/mol |
| Exact Mass | 245.17 |
| IUPAC Name | 2-dimethoxyphosphoryl-1-(1,2,2,3,3,4,4,5,5,6,6-undecadeuteriocyclohexyl)ethanone |
| SMILES | [2H]C1([2H])C([2H])([2H])C([2H])([2H])C([2H])(C(=O)CP(=O)(OC)OC)C([2H])([2H])C1([2H])[2H] |
| InChI | InChI=1S/C10H19O4P/c1-13-15(12,14-2)8-10(11)9-6-4-3-5-7-9/h9H,3-8H2,1-2H3/i3D2,4D2,5D2,6D2,7D2,9D |
| InChIKey | FTZNMXSYERMMBC-QFAYMVOLSA-N |
| XLogP | 2.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.30 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|