C9H17F2O4P — CID 11118722
1-dimethoxyphosphoryl-3,3-difluoroheptan-2-one (PubChem CID 11118722) has the molecular formula C9H17F2O4P and a molecular weight of 258.20 g/mol. Its IUPAC name is 1-dimethoxyphosphoryl-3,3-difluoroheptan-2-one.
| Compound Name | 1-dimethoxyphosphoryl-3,3-difluoroheptan-2-one |
|---|---|
| PubChem CID | 11118722 |
| Molecular Formula | C9H17F2O4P |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.08 |
| IUPAC Name | 1-dimethoxyphosphoryl-3,3-difluoroheptan-2-one |
| SMILES | CCCCC(F)(F)C(=O)CP(=O)(OC)OC |
| InChI | InChI=1S/C9H17F2O4P/c1-4-5-6-9(10,11)8(12)7-16(13,14-2)15-3/h4-7H2,1-3H3 |
| InChIKey | CISDEVRDMKWPCP-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|