C11H21F2O4P — CID 57176391
3,3-difluoro-1-[methoxy(methyl)phosphoryl]oxynonan-2-one (PubChem CID 57176391) has the molecular formula C11H21F2O4P and a molecular weight of 286.25 g/mol. Its IUPAC name is 3,3-difluoro-1-[methoxy(methyl)phosphoryl]oxynonan-2-one.
| Compound Name | 3,3-difluoro-1-[methoxy(methyl)phosphoryl]oxynonan-2-one |
|---|---|
| PubChem CID | 57176391 |
| Molecular Formula | C11H21F2O4P |
| Molecular Weight | 286.25 g/mol |
| Exact Mass | 286.11 |
| IUPAC Name | 3,3-difluoro-1-[methoxy(methyl)phosphoryl]oxynonan-2-one |
| SMILES | CCCCCCC(F)(F)C(=O)COP(C)(=O)OC |
| InChI | InChI=1S/C11H21F2O4P/c1-4-5-6-7-8-11(12,13)10(14)9-17-18(3,15)16-2/h4-9H2,1-3H3 |
| InChIKey | PZSMONWWKKCWDV-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.25 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|