C16H29F4O4P — CID 161084046
3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one (PubChem CID 161084046) has the molecular formula C16H29F4O4P and a molecular weight of 392.37 g/mol. Its IUPAC name is 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one.
| Compound Name | 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one |
|---|---|
| PubChem CID | 161084046 |
| Molecular Formula | C16H29F4O4P |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one |
| SMILES | CCCCC(F)(F)C(=O)CP(C)(=O)OC.CCCCC(F)(F)C(C)=O |
| InChI | InChI=1S/C9H17F2O3P.C7H12F2O/c1-4-5-6-9(10,11)8(12)7-15(3,13)14-2;1-3-4-5-7(8,9)6(2)10/h4-7H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | UGGSVLUOVSTWIR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|