About 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one
3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one (PubChem CID 161084046) has the molecular formula C16H29F4O4P
and a molecular weight of 392.37 g/mol. Its IUPAC name is 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one.
Molecular Properties
| Compound Name | 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one |
| PubChem CID | 161084046 |
| Molecular Formula | C16H29F4O4P |
| Molecular Weight | 392.37 g/mol |
| Exact Mass | 392.17 |
| IUPAC Name | 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one |
| SMILES | CCCCC(F)(F)C(=O)CP(C)(=O)OC.CCCCC(F)(F)C(C)=O |
| InChI | InChI=1S/C9H17F2O3P.C7H12F2O/c1-4-5-6-9(10,11)8(12)7-15(3,13)14-2;1-3-4-5-7(8,9)6(2)10/h4-7H2,1-3H3;3-5H2,1-2H3 |
| InChIKey | UGGSVLUOVSTWIR-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 392.37 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one?
The IUPAC name of 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one (CID 161084046) is 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one.
What is the SMILES notation for 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one?
The canonical SMILES for 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one is CCCCC(F)(F)C(=O)CP(C)(=O)OC.CCCCC(F)(F)C(C)=O.
What is the InChIKey of 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one?
The InChIKey is UGGSVLUOVSTWIR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17F2O3P.C7H12F2O/c1-4-5-6-9(10,11)8(12)7-15(3,13)14-2;1-3-4-5-7(8,9)6(2)10/h4-7H2,1-3H3;3-5H2,1-2H3.
What are the key properties of 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one?
3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one has a molecular weight of 392.37 g/mol, XLogP of 5.34, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-difluoroheptan-2-one;3,3-difluoro-1-[methoxy(methyl)phosphoryl]heptan-2-one is sourced from PubChem (CID 161084046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).