About 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate
1-dimethoxyphosphorylheptan-2-one;methyl hexanoate (PubChem CID 121271648) has the molecular formula C16H33O6P
and a molecular weight of 352.41 g/mol. Its IUPAC name is 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate.
Molecular Properties
| Compound Name | 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate |
| PubChem CID | 121271648 |
| Molecular Formula | C16H33O6P |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.20 |
| IUPAC Name | 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate |
| SMILES | CCCCCC(=O)CP(=O)(OC)OC.CCCCCC(=O)OC |
| InChI | InChI=1S/C9H19O4P.C7H14O2/c1-4-5-6-7-9(10)8-14(11,12-2)13-3;1-3-4-5-6-7(8)9-2/h4-8H2,1-3H3;3-6H2,1-2H3 |
| InChIKey | YIGHXISAOOQPFK-UHFFFAOYSA-N |
| XLogP | 4.36 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate?
The IUPAC name of 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate (CID 121271648) is 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate.
What is the SMILES notation for 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate?
The canonical SMILES for 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate is CCCCCC(=O)CP(=O)(OC)OC.CCCCCC(=O)OC.
What is the InChIKey of 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate?
The InChIKey is YIGHXISAOOQPFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19O4P.C7H14O2/c1-4-5-6-7-9(10)8-14(11,12-2)13-3;1-3-4-5-6-7(8)9-2/h4-8H2,1-3H3;3-6H2,1-2H3.
What are the key properties of 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate?
1-dimethoxyphosphorylheptan-2-one;methyl hexanoate has a molecular weight of 352.41 g/mol, XLogP of 4.36, 12 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-dimethoxyphosphorylheptan-2-one;methyl hexanoate is sourced from PubChem (CID 121271648), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).