C9H16O5 — CID 10560108
3-hydroperoxy-3-methyl-1,2,5-trioxaspiro[5.5]undecane (PubChem CID 10560108) has the molecular formula C9H16O5 and a molecular weight of 204.22 g/mol. Its IUPAC name is 3-hydroperoxy-3-methyl-1,2,5-trioxaspiro[5.5]undecane.
| Compound Name | 3-hydroperoxy-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10560108 |
| Molecular Formula | C9H16O5 |
| Molecular Weight | 204.22 g/mol |
| Exact Mass | 204.10 |
| IUPAC Name | 3-hydroperoxy-3-methyl-1,2,5-trioxaspiro[5.5]undecane |
| SMILES | CC1(OO)COC2(CCCCC2)OO1 |
| InChI | InChI=1S/C9H16O5/c1-8(12-10)7-11-9(14-13-8)5-3-2-4-6-9/h10H,2-7H2,1H3 |
| InChIKey | BTCCHBZNAALYPW-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|