C9H14O4 — CID 46210798
8-methyl-6,7,10-trioxaspiro[4.5]decane-8-carbaldehyde (PubChem CID 46210798) has the molecular formula C9H14O4 and a molecular weight of 186.21 g/mol. Its IUPAC name is 8-methyl-6,7,10-trioxaspiro[4.5]decane-8-carbaldehyde.
| Compound Name | 8-methyl-6,7,10-trioxaspiro[4.5]decane-8-carbaldehyde |
|---|---|
| PubChem CID | 46210798 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | 8-methyl-6,7,10-trioxaspiro[4.5]decane-8-carbaldehyde |
| SMILES | CC1(C=O)COC2(CCCC2)OO1 |
| InChI | InChI=1S/C9H14O4/c1-8(6-10)7-11-9(13-12-8)4-2-3-5-9/h6H,2-5,7H2,1H3 |
| InChIKey | ZPOWXVFRNPKUHO-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|