C13H22O6 — CID 85281037
3-methyl-3-(3,5,5-trimethyl-1,2,4-trioxolan-3-yl)-1,2,4-trioxaspiro[4.5]decane (PubChem CID 85281037) has the molecular formula C13H22O6 and a molecular weight of 274.31 g/mol. Its IUPAC name is 3-methyl-3-(3,5,5-trimethyl-1,2,4-trioxolan-3-yl)-1,2,4-trioxaspiro[4.5]decane.
| Compound Name | 3-methyl-3-(3,5,5-trimethyl-1,2,4-trioxolan-3-yl)-1,2,4-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 85281037 |
| Molecular Formula | C13H22O6 |
| Molecular Weight | 274.31 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | 3-methyl-3-(3,5,5-trimethyl-1,2,4-trioxolan-3-yl)-1,2,4-trioxaspiro[4.5]decane |
| SMILES | CC1(C)OOC(C)(C2(C)OOC3(CCCCC3)O2)O1 |
| InChI | InChI=1S/C13H22O6/c1-10(2)14-11(3,17-16-10)12(4)15-13(19-18-12)8-6-5-7-9-13/h5-9H2,1-4H3 |
| InChIKey | MOLBBBKCINAPDL-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|