C10H18O5 — CID 134896179
8-(2-hydroperoxypropan-2-yl)-6,7,10-trioxaspiro[4.5]decane (PubChem CID 134896179) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 8-(2-hydroperoxypropan-2-yl)-6,7,10-trioxaspiro[4.5]decane.
| Compound Name | 8-(2-hydroperoxypropan-2-yl)-6,7,10-trioxaspiro[4.5]decane |
|---|---|
| PubChem CID | 134896179 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 8-(2-hydroperoxypropan-2-yl)-6,7,10-trioxaspiro[4.5]decane |
| SMILES | CC(C)(OO)C1COC2(CCCC2)OO1 |
| InChI | InChI=1S/C10H18O5/c1-9(2,14-11)8-7-12-10(15-13-8)5-3-4-6-10/h8,11H,3-7H2,1-2H3 |
| InChIKey | LIGBMZOOAFERGD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 57.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|