C16H34O4Si2 — CID 122183191
3-tert-butyl-9,9,12,12-tetramethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane (PubChem CID 122183191) has the molecular formula C16H34O4Si2 and a molecular weight of 346.62 g/mol. Its IUPAC name is 3-tert-butyl-9,9,12,12-tetramethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane.
| Compound Name | 3-tert-butyl-9,9,12,12-tetramethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane |
|---|---|
| PubChem CID | 122183191 |
| Molecular Formula | C16H34O4Si2 |
| Molecular Weight | 346.62 g/mol |
| Exact Mass | 346.20 |
| IUPAC Name | 3-tert-butyl-9,9,12,12-tetramethyl-7,8,13,14-tetraoxa-9,12-disilaspiro[5.8]tetradecane |
| SMILES | CC(C)(C)C1CCC2(CC1)OO[Si](C)(C)CC[Si](C)(C)OO2 |
| InChI | InChI=1S/C16H34O4Si2/c1-15(2,3)14-8-10-16(11-9-14)17-19-21(4,5)12-13-22(6,7)20-18-16/h14H,8-13H2,1-7H3 |
| InChIKey | NOUZLRUYHBVHSY-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.62 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|