C15H28O3 — CID 101355186
3-tert-butyl-9,9-dimethyl-7,8,12-trioxaspiro[5.6]dodecane (PubChem CID 101355186) has the molecular formula C15H28O3 and a molecular weight of 256.39 g/mol. Its IUPAC name is 3-tert-butyl-9,9-dimethyl-7,8,12-trioxaspiro[5.6]dodecane.
| Compound Name | 3-tert-butyl-9,9-dimethyl-7,8,12-trioxaspiro[5.6]dodecane |
|---|---|
| PubChem CID | 101355186 |
| Molecular Formula | C15H28O3 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.20 |
| IUPAC Name | 3-tert-butyl-9,9-dimethyl-7,8,12-trioxaspiro[5.6]dodecane |
| SMILES | CC1(C)CCOC2(CCC(C(C)(C)C)CC2)OO1 |
| InChI | InChI=1S/C15H28O3/c1-13(2,3)12-6-8-15(9-7-12)16-11-10-14(4,5)17-18-15/h12H,6-11H2,1-5H3 |
| InChIKey | QAURPBVNNOTXNS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|