C13H24S2 — CID 10999291
9-tert-butyl-1,5-dithiaspiro[5.5]undecane (PubChem CID 10999291) has the molecular formula C13H24S2 and a molecular weight of 244.47 g/mol. Its IUPAC name is 9-tert-butyl-1,5-dithiaspiro[5.5]undecane.
| Compound Name | 9-tert-butyl-1,5-dithiaspiro[5.5]undecane |
|---|---|
| PubChem CID | 10999291 |
| Molecular Formula | C13H24S2 |
| Molecular Weight | 244.47 g/mol |
| Exact Mass | 244.13 |
| IUPAC Name | 9-tert-butyl-1,5-dithiaspiro[5.5]undecane |
| SMILES | CC(C)(C)C1CCC2(CC1)SCCCS2 |
| InChI | InChI=1S/C13H24S2/c1-12(2,3)11-5-7-13(8-6-11)14-9-4-10-15-13/h11H,4-10H2,1-3H3 |
| InChIKey | IEGZEWACYOGSRS-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.47 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |