About 2-azoniaspiro[3.5]nonane
2-azoniaspiro[3.5]nonane (PubChem CID 28901654) has the molecular formula C8H16N+
and a molecular weight of 126.22 g/mol. Its IUPAC name is 2-azoniaspiro[3.5]nonane.
Molecular Properties
| Compound Name | 2-azoniaspiro[3.5]nonane |
| PubChem CID | 28901654 |
| Molecular Formula | C8H16N+ |
| Molecular Weight | 126.22 g/mol |
| Exact Mass | 126.13 |
| IUPAC Name | 2-azoniaspiro[3.5]nonane |
| SMILES | C1CCC2(CC1)C[NH2+]C2 |
| InChI | InChI=1S/C8H15N/c1-2-4-8(5-3-1)6-9-7-8/h9H,1-7H2/p+1 |
| InChIKey | IBODJKKYTBNWTD-UHFFFAOYSA-O |
| XLogP | 0.51 |
| TPSA | 16.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 126.22 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-azoniaspiro[3.5]nonane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-azoniaspiro[3.5]nonane?
The IUPAC name of 2-azoniaspiro[3.5]nonane (CID 28901654) is 2-azoniaspiro[3.5]nonane.
What is the SMILES notation for 2-azoniaspiro[3.5]nonane?
The canonical SMILES for 2-azoniaspiro[3.5]nonane is C1CCC2(CC1)C[NH2+]C2.
What is the InChIKey of 2-azoniaspiro[3.5]nonane?
The InChIKey is IBODJKKYTBNWTD-UHFFFAOYSA-O. The full InChI is InChI=1S/C8H15N/c1-2-4-8(5-3-1)6-9-7-8/h9H,1-7H2/p+1.
What are the key properties of 2-azoniaspiro[3.5]nonane?
2-azoniaspiro[3.5]nonane has a molecular weight of 126.22 g/mol, XLogP of 0.51, 0 rotatable bonds, 1 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-azoniaspiro[3.5]nonane is sourced from PubChem (CID 28901654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).