H7NO18P6 — CID 173394555
O-(4,6,8,10,12-pentahydroxy-2,4,6,8,10,12-hexaoxo-1,3,5,7,9,11-hexaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododec-2-yl)hydroxylamine (PubChem CID 173394555) has the molecular formula H7NO18P6 and a molecular weight of 494.89 g/mol. Its IUPAC name is O-(4,6,8,10,12-pentahydroxy-2,4,6,8,10,12-hexaoxo-1,3,5,7,9,11-hexaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododec-2-yl)hydroxylamine.
| Compound Name | O-(4,6,8,10,12-pentahydroxy-2,4,6,8,10,12-hexaoxo-1,3,5,7,9,11-hexaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododec-2-yl)hydroxylamine |
|---|---|
| PubChem CID | 173394555 |
| Molecular Formula | H7NO18P6 |
| Molecular Weight | 494.89 g/mol |
| Exact Mass | 494.81 |
| IUPAC Name | O-(4,6,8,10,12-pentahydroxy-2,4,6,8,10,12-hexaoxo-1,3,5,7,9,11-hexaoxa-2λ5,4λ5,6λ5,8λ5,10λ5,12λ5-hexaphosphacyclododec-2-yl)hydroxylamine |
| SMILES | NOP1(=O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)OP(=O)(O)O1 |
| InChI | InChI=1S/H7NO18P6/c1-13-25(12)18-23(8,9)16-21(4,5)14-20(2,3)15-22(6,7)17-24(10,11)19-25/h1H2,(H,2,3)(H,4,5)(H,6,7)(H,8,9)(H,10,11) |
| InChIKey | DULVTQHTEZSQQX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 294.20 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.89 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|