C4H7O11P3 — CID 139906485
(E)-2-[(4,6-dihydroxy-2,4,6-trioxo-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)oxy]but-2-enoic acid (PubChem CID 139906485) has the molecular formula C4H7O11P3 and a molecular weight of 324.01 g/mol. Its IUPAC name is (E)-2-[(4,6-dihydroxy-2,4,6-trioxo-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)oxy]but-2-enoic acid.
| Compound Name | (E)-2-[(4,6-dihydroxy-2,4,6-trioxo-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)oxy]but-2-enoic acid |
|---|---|
| PubChem CID | 139906485 |
| Molecular Formula | C4H7O11P3 |
| Molecular Weight | 324.01 g/mol |
| Exact Mass | 323.92 |
| IUPAC Name | (E)-2-[(4,6-dihydroxy-2,4,6-trioxo-1,3,5,2λ5,4λ5,6λ5-trioxatriphosphinan-2-yl)oxy]but-2-enoic acid |
| SMILES | C/C=C(/OP1(=O)OP(=O)(O)OP(=O)(O)O1)C(=O)O |
| InChI | InChI=1S/C4H7O11P3/c1-2-3(4(5)6)12-18(11)14-16(7,8)13-17(9,10)15-18/h2H,1H3,(H,5,6)(H,7,8)(H,9,10)/b3-2+ |
| InChIKey | BUGGLETVWHEUKT-NSCUHMNNSA-N |
| XLogP | 1.36 |
| TPSA | 165.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.01 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|