H2NO5P — CID 173422527
O-(4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)hydroxylamine (PubChem CID 173422527) has the molecular formula H2NO5P and a molecular weight of 126.99 g/mol. Its IUPAC name is O-(4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)hydroxylamine.
| Compound Name | O-(4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)hydroxylamine |
|---|---|
| PubChem CID | 173422527 |
| Molecular Formula | H2NO5P |
| Molecular Weight | 126.99 g/mol |
| Exact Mass | 126.97 |
| IUPAC Name | O-(4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)hydroxylamine |
| SMILES | NOP1(=O)OOO1 |
| InChI | InChI=1S/H2NO5P/c1-3-7(2)5-4-6-7/h1H2 |
| InChIKey | GIOCUXFWTQALEZ-UHFFFAOYSA-N |
| XLogP | -0.12 |
| TPSA | 80.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.99 |
| LogP ≤ 5 | -0.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|