H3O5PSi — CID 159459331
(4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)oxysilane (PubChem CID 159459331) has the molecular formula H3O5PSi and a molecular weight of 142.08 g/mol. Its IUPAC name is (4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)oxysilane.
| Compound Name | (4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)oxysilane |
|---|---|
| PubChem CID | 159459331 |
| Molecular Formula | H3O5PSi |
| Molecular Weight | 142.08 g/mol |
| Exact Mass | 141.95 |
| IUPAC Name | (4-oxo-1,2,3,4λ5-trioxaphosphetan-4-yl)oxysilane |
| SMILES | O=P1(O[SiH3])OOO1 |
| InChI | InChI=1S/H3O5PSi/c1-6(5-7)3-2-4-6/h7H3 |
| InChIKey | LUJRQDDJWFCANL-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.08 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|