C4H9O7P — CID 142684303
3-ethylperoxy-6-methyl-1,2,4,5,3λ5-tetraoxaphosphinane 3-oxide (PubChem CID 142684303) has the molecular formula C4H9O7P and a molecular weight of 200.08 g/mol. Its IUPAC name is 3-ethylperoxy-6-methyl-1,2,4,5,3λ5-tetraoxaphosphinane 3-oxide.
| Compound Name | 3-ethylperoxy-6-methyl-1,2,4,5,3λ5-tetraoxaphosphinane 3-oxide |
|---|---|
| PubChem CID | 142684303 |
| Molecular Formula | C4H9O7P |
| Molecular Weight | 200.08 g/mol |
| Exact Mass | 200.01 |
| IUPAC Name | 3-ethylperoxy-6-methyl-1,2,4,5,3λ5-tetraoxaphosphinane 3-oxide |
| SMILES | CCOOP1(=O)OOC(C)OO1 |
| InChI | InChI=1S/C4H9O7P/c1-3-6-9-12(5)10-7-4(2)8-11-12/h4H,3H2,1-2H3 |
| InChIKey | KJRCPHXOMCPELO-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.08 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|