C11H21O6P — CID 142351805
ethyl (2S)-2-methyl-4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butanoate (PubChem CID 142351805) has the molecular formula C11H21O6P and a molecular weight of 280.26 g/mol. Its IUPAC name is ethyl (2S)-2-methyl-4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butanoate.
| Compound Name | ethyl (2S)-2-methyl-4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butanoate |
|---|---|
| PubChem CID | 142351805 |
| Molecular Formula | C11H21O6P |
| Molecular Weight | 280.26 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | ethyl (2S)-2-methyl-4-[(5-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-yl)oxy]butanoate |
| SMILES | CCOC(=O)[C@@H](C)CCOP1(=O)OCC(C)CO1 |
| InChI | InChI=1S/C11H21O6P/c1-4-14-11(12)10(3)5-6-15-18(13)16-7-9(2)8-17-18/h9-10H,4-8H2,1-3H3/t9?,10-,18?/m0/s1 |
| InChIKey | LRZJRWKWDFOGLJ-GYEYZBBESA-N |
| XLogP | 2.38 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.26 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|