About sodium;ethoxyethane;ethoxy sulfate
sodium;ethoxyethane;ethoxy sulfate (PubChem CID 88747488) has the molecular formula C6H15NaO6S
and a molecular weight of 238.24 g/mol. Its IUPAC name is sodium;ethoxyethane;ethoxy sulfate.
Molecular Properties
| Compound Name | sodium;ethoxyethane;ethoxy sulfate |
| PubChem CID | 88747488 |
| Molecular Formula | C6H15NaO6S |
| Molecular Weight | 238.24 g/mol |
| Exact Mass | 238.05 |
| IUPAC Name | sodium;ethoxyethane;ethoxy sulfate |
| SMILES | CCOCC.CCOOS(=O)(=O)[O-].[Na+] |
| InChI | InChI=1S/C4H10O.C2H6O5S.Na/c1-3-5-4-2;1-2-6-7-8(3,4)5;/h3-4H2,1-2H3;2H2,1H3,(H,3,4,5);/q;;+1/p-1 |
| InChIKey | LLNFETYYAKDEEF-UHFFFAOYSA-M |
| XLogP | -2.54 |
| TPSA | 84.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.24 |
| LogP ≤ 5 | -2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulphate', 'substructure': 'N/A'} |
|---|
Analyze sodium;ethoxyethane;ethoxy sulfate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;ethoxyethane;ethoxy sulfate?
The IUPAC name of sodium;ethoxyethane;ethoxy sulfate (CID 88747488) is sodium;ethoxyethane;ethoxy sulfate.
What is the SMILES notation for sodium;ethoxyethane;ethoxy sulfate?
The canonical SMILES for sodium;ethoxyethane;ethoxy sulfate is CCOCC.CCOOS(=O)(=O)[O-].[Na+].
What is the InChIKey of sodium;ethoxyethane;ethoxy sulfate?
The InChIKey is LLNFETYYAKDEEF-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10O.C2H6O5S.Na/c1-3-5-4-2;1-2-6-7-8(3,4)5;/h3-4H2,1-2H3;2H2,1H3,(H,3,4,5);/q;;+1/p-1.
What are the key properties of sodium;ethoxyethane;ethoxy sulfate?
sodium;ethoxyethane;ethoxy sulfate has a molecular weight of 238.24 g/mol, XLogP of -2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;ethoxyethane;ethoxy sulfate is sourced from PubChem (CID 88747488), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).