About azane;diaminooxy(oxo)azanium
azane;diaminooxy(oxo)azanium (PubChem CID 173233557) has the molecular formula H7N4O3+
and a molecular weight of 111.08 g/mol. Its IUPAC name is azane;diaminooxy(oxo)azanium.
Molecular Properties
| Compound Name | azane;diaminooxy(oxo)azanium |
| PubChem CID | 173233557 |
| Molecular Formula | H7N4O3+ |
| Molecular Weight | 111.08 g/mol |
| Exact Mass | 111.05 |
| IUPAC Name | azane;diaminooxy(oxo)azanium |
| SMILES | N.NO[N+](=O)ON |
| InChI | InChI=1S/H4N3O3.H3N/c1-5-3(4)6-2;/h1-2H2;1H3/q+1; |
| InChIKey | HSEUYEOIMBPPAW-UHFFFAOYSA-N |
| XLogP | -1.46 |
| TPSA | 125.58 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 111.08 |
| LogP ≤ 5 | -1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze azane;diaminooxy(oxo)azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;diaminooxy(oxo)azanium?
The IUPAC name of azane;diaminooxy(oxo)azanium (CID 173233557) is azane;diaminooxy(oxo)azanium.
What is the SMILES notation for azane;diaminooxy(oxo)azanium?
The canonical SMILES for azane;diaminooxy(oxo)azanium is N.NO[N+](=O)ON.
What is the InChIKey of azane;diaminooxy(oxo)azanium?
The InChIKey is HSEUYEOIMBPPAW-UHFFFAOYSA-N. The full InChI is InChI=1S/H4N3O3.H3N/c1-5-3(4)6-2;/h1-2H2;1H3/q+1;.
What are the key properties of azane;diaminooxy(oxo)azanium?
azane;diaminooxy(oxo)azanium has a molecular weight of 111.08 g/mol, XLogP of -1.46, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for azane;diaminooxy(oxo)azanium is sourced from PubChem (CID 173233557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).