[amino(2-hydrazinylethyl)amino] nitrate

C2H9N5O3 — CID 170698240

IUPAC[amino(2-hydrazinylethyl)amino] nitrate
SMILESNNCCN(N)O[N+](=O)[O-]
InChIInChI=1S/C2H9N5O3/c3-5-1-2-6(4)10-7(8)9/h5H,1-4H2
InChIKeyLXZROBMPPLWNQD-UHFFFAOYSA-N
MW151.13 g/mol
LogP-2.25
Rot. Bonds5

About [amino(2-hydrazinylethyl)amino] nitrate

[amino(2-hydrazinylethyl)amino] nitrate (PubChem CID 170698240) has the molecular formula C2H9N5O3 and a molecular weight of 151.13 g/mol. Its IUPAC name is [amino(2-hydrazinylethyl)amino] nitrate.

Molecular Properties

Compound Name[amino(2-hydrazinylethyl)amino] nitrate
PubChem CID170698240
Molecular FormulaC2H9N5O3
Molecular Weight151.13 g/mol
Exact Mass151.07
IUPAC Name[amino(2-hydrazinylethyl)amino] nitrate
SMILESNNCCN(N)O[N+](=O)[O-]
InChIInChI=1S/C2H9N5O3/c3-5-1-2-6(4)10-7(8)9/h5H,1-4H2
InChIKeyLXZROBMPPLWNQD-UHFFFAOYSA-N
XLogP-2.25
TPSA119.68 Ų
H-Bond Donors3
H-Bond Acceptors7
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500151.13
LogP ≤ 5-2.25
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 107

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze [amino(2-hydrazinylethyl)amino] nitrate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

[amino-[2-(diethylamino)ethyl]amino] nitrate
CID 170698232
[amino-[2-(dipropylamino)ethyl]amino] nitrate
CID 170698241
(dinitroamino) nitrate
CID 154311822
hexakis(ethyl N-aminocarbamate);bis(nickel(2+));tetranitrate
CID 139074128
amino nitrate;mercury
CID 174849220
amino nitrate;platinum
CID 174487148
amino nitrate;guanidine
CID 87093007
1-(2-aminoethyl)-1-nitrourea
CID 141425314
N,N-diethyl-2-hydrazinylethanamine
CID 3028735
bismuthane;nitro nitrate
CID 174723286
azane;hydroxy nitrate
CID 173145569
azane;hydroxylamine;N-hydroxynitramide
CID 173388904

Frequently Asked Questions

What is the IUPAC name of [amino(2-hydrazinylethyl)amino] nitrate?
The IUPAC name of [amino(2-hydrazinylethyl)amino] nitrate (CID 170698240) is [amino(2-hydrazinylethyl)amino] nitrate.
What is the SMILES notation for [amino(2-hydrazinylethyl)amino] nitrate?
The canonical SMILES for [amino(2-hydrazinylethyl)amino] nitrate is NNCCN(N)O[N+](=O)[O-].
What is the InChIKey of [amino(2-hydrazinylethyl)amino] nitrate?
The InChIKey is LXZROBMPPLWNQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H9N5O3/c3-5-1-2-6(4)10-7(8)9/h5H,1-4H2.
What are the key properties of [amino(2-hydrazinylethyl)amino] nitrate?
[amino(2-hydrazinylethyl)amino] nitrate has a molecular weight of 151.13 g/mol, XLogP of -2.25, 5 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for [amino(2-hydrazinylethyl)amino] nitrate is sourced from PubChem (CID 170698240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).