C6H17N3 — CID 3028735
N,N-diethyl-2-hydrazinylethanamine (PubChem CID 3028735) has the molecular formula C6H17N3 and a molecular weight of 131.22 g/mol. Its IUPAC name is N,N-diethyl-2-hydrazinylethanamine.
| Compound Name | N,N-diethyl-2-hydrazinylethanamine |
|---|---|
| PubChem CID | 3028735 |
| Molecular Formula | C6H17N3 |
| Molecular Weight | 131.22 g/mol |
| Exact Mass | 131.14 |
| IUPAC Name | N,N-diethyl-2-hydrazinylethanamine |
| SMILES | CCN(CC)CCNN |
| InChI | InChI=1S/C6H17N3/c1-3-9(4-2)6-5-8-7/h8H,3-7H2,1-2H3 |
| InChIKey | ANNHHDONMUBVSB-UHFFFAOYSA-N |
| XLogP | -0.21 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.22 |
| LogP ≤ 5 | -0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|