C11H30N6 — CID 122530533
N,N'-bis(2-hydrazinylethyl)-N'-pentylethane-1,2-diamine (PubChem CID 122530533) has the molecular formula C11H30N6 and a molecular weight of 246.40 g/mol. Its IUPAC name is N,N'-bis(2-hydrazinylethyl)-N'-pentylethane-1,2-diamine.
| Compound Name | N,N'-bis(2-hydrazinylethyl)-N'-pentylethane-1,2-diamine |
|---|---|
| PubChem CID | 122530533 |
| Molecular Formula | C11H30N6 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.25 |
| IUPAC Name | N,N'-bis(2-hydrazinylethyl)-N'-pentylethane-1,2-diamine |
| SMILES | CCCCCN(CCNN)CCNCCNN |
| InChI | InChI=1S/C11H30N6/c1-2-3-4-9-17(11-8-16-13)10-7-14-5-6-15-12/h14-16H,2-13H2,1H3 |
| InChIKey | YNMMIXHPJDERGR-UHFFFAOYSA-N |
| XLogP | -1.01 |
| TPSA | 91.37 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|