C10H26N4 — CID 123998123
1-N-[2-(diethylamino)ethyl]-1-N',1-N'-dimethylethane-1,1,2-triamine (PubChem CID 123998123) has the molecular formula C10H26N4 and a molecular weight of 202.35 g/mol. Its IUPAC name is 1-N-[2-(diethylamino)ethyl]-1-N',1-N'-dimethylethane-1,1,2-triamine.
| Compound Name | 1-N-[2-(diethylamino)ethyl]-1-N',1-N'-dimethylethane-1,1,2-triamine |
|---|---|
| PubChem CID | 123998123 |
| Molecular Formula | C10H26N4 |
| Molecular Weight | 202.35 g/mol |
| Exact Mass | 202.22 |
| IUPAC Name | 1-N-[2-(diethylamino)ethyl]-1-N',1-N'-dimethylethane-1,1,2-triamine |
| SMILES | CCN(CC)CCNC(CN)N(C)C |
| InChI | InChI=1S/C10H26N4/c1-5-14(6-2)8-7-12-10(9-11)13(3)4/h10,12H,5-9,11H2,1-4H3 |
| InChIKey | QTWHRMJZPMJHKX-UHFFFAOYSA-N |
| XLogP | -0.24 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.35 |
| LogP ≤ 5 | -0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|