C13H30N4O — CID 66430169
4-amino-3-[2-(diethylamino)ethylamino]-N-propan-2-ylbutanamide (PubChem CID 66430169) has the molecular formula C13H30N4O and a molecular weight of 258.41 g/mol. Its IUPAC name is 4-amino-3-[2-(diethylamino)ethylamino]-N-propan-2-ylbutanamide.
| Compound Name | 4-amino-3-[2-(diethylamino)ethylamino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 66430169 |
| Molecular Formula | C13H30N4O |
| Molecular Weight | 258.41 g/mol |
| Exact Mass | 258.24 |
| IUPAC Name | 4-amino-3-[2-(diethylamino)ethylamino]-N-propan-2-ylbutanamide |
| SMILES | CCN(CC)CCNC(CN)CC(=O)NC(C)C |
| InChI | InChI=1S/C13H30N4O/c1-5-17(6-2)8-7-15-12(10-14)9-13(18)16-11(3)4/h11-12,15H,5-10,14H2,1-4H3,(H,16,18) |
| InChIKey | NENXOANEYQDJLC-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 70.39 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.41 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |