C13H31N3 — CID 65382937
2-N-[2-(diethylamino)ethyl]-3-ethylpentane-1,2-diamine (PubChem CID 65382937) has the molecular formula C13H31N3 and a molecular weight of 229.41 g/mol. Its IUPAC name is 2-N-[2-(diethylamino)ethyl]-3-ethylpentane-1,2-diamine.
| Compound Name | 2-N-[2-(diethylamino)ethyl]-3-ethylpentane-1,2-diamine |
|---|---|
| PubChem CID | 65382937 |
| Molecular Formula | C13H31N3 |
| Molecular Weight | 229.41 g/mol |
| Exact Mass | 229.25 |
| IUPAC Name | 2-N-[2-(diethylamino)ethyl]-3-ethylpentane-1,2-diamine |
| SMILES | CCC(CC)C(CN)NCCN(CC)CC |
| InChI | InChI=1S/C13H31N3/c1-5-12(6-2)13(11-14)15-9-10-16(7-3)8-4/h12-13,15H,5-11,14H2,1-4H3 |
| InChIKey | VFVUYHDJPRQJAM-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.41 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |