C12H27ClN2 — CID 106353902
N-(1-chloro-4-methylpentan-3-yl)-N',N'-diethylethane-1,2-diamine (PubChem CID 106353902) has the molecular formula C12H27ClN2 and a molecular weight of 234.81 g/mol. Its IUPAC name is N-(1-chloro-4-methylpentan-3-yl)-N',N'-diethylethane-1,2-diamine.
| Compound Name | N-(1-chloro-4-methylpentan-3-yl)-N',N'-diethylethane-1,2-diamine |
|---|---|
| PubChem CID | 106353902 |
| Molecular Formula | C12H27ClN2 |
| Molecular Weight | 234.81 g/mol |
| Exact Mass | 234.19 |
| IUPAC Name | N-(1-chloro-4-methylpentan-3-yl)-N',N'-diethylethane-1,2-diamine |
| SMILES | CCN(CC)CCNC(CCCl)C(C)C |
| InChI | InChI=1S/C12H27ClN2/c1-5-15(6-2)10-9-14-12(7-8-13)11(3)4/h11-12,14H,5-10H2,1-4H3 |
| InChIKey | RDVXMVIVHKWHKF-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.81 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|