C15H34N2 — CID 107896692
1-N,1-N-diethyl-4-methyl-3-N-propylheptane-1,3-diamine (PubChem CID 107896692) has the molecular formula C15H34N2 and a molecular weight of 242.45 g/mol. Its IUPAC name is 1-N,1-N-diethyl-4-methyl-3-N-propylheptane-1,3-diamine.
| Compound Name | 1-N,1-N-diethyl-4-methyl-3-N-propylheptane-1,3-diamine |
|---|---|
| PubChem CID | 107896692 |
| Molecular Formula | C15H34N2 |
| Molecular Weight | 242.45 g/mol |
| Exact Mass | 242.27 |
| IUPAC Name | 1-N,1-N-diethyl-4-methyl-3-N-propylheptane-1,3-diamine |
| SMILES | CCCNC(CCN(CC)CC)C(C)CCC |
| InChI | InChI=1S/C15H34N2/c1-6-10-14(5)15(16-12-7-2)11-13-17(8-3)9-4/h14-16H,6-13H2,1-5H3 |
| InChIKey | UCJRUQOWMGDIEV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.45 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |