C12H29N3 — CID 107441031
N'-[2-(diethylamino)ethyl]-2-propan-2-ylpropane-1,3-diamine (PubChem CID 107441031) has the molecular formula C12H29N3 and a molecular weight of 215.38 g/mol. Its IUPAC name is N'-[2-(diethylamino)ethyl]-2-propan-2-ylpropane-1,3-diamine.
| Compound Name | N'-[2-(diethylamino)ethyl]-2-propan-2-ylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107441031 |
| Molecular Formula | C12H29N3 |
| Molecular Weight | 215.38 g/mol |
| Exact Mass | 215.24 |
| IUPAC Name | N'-[2-(diethylamino)ethyl]-2-propan-2-ylpropane-1,3-diamine |
| SMILES | CCN(CC)CCNCC(CN)C(C)C |
| InChI | InChI=1S/C12H29N3/c1-5-15(6-2)8-7-14-10-12(9-13)11(3)4/h11-12,14H,5-10,13H2,1-4H3 |
| InChIKey | GFKDQXHMUSTDNH-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.38 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|