C14H33N3 — CID 55089958
N-[2-(diethylamino)ethyl]-N'-methyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine (PubChem CID 55089958) has the molecular formula C14H33N3 and a molecular weight of 243.44 g/mol. Its IUPAC name is N-[2-(diethylamino)ethyl]-N'-methyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine.
| Compound Name | N-[2-(diethylamino)ethyl]-N'-methyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine |
|---|---|
| PubChem CID | 55089958 |
| Molecular Formula | C14H33N3 |
| Molecular Weight | 243.44 g/mol |
| Exact Mass | 243.27 |
| IUPAC Name | N-[2-(diethylamino)ethyl]-N'-methyl-N'-(3-methylbutan-2-yl)ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCN(C)C(C)C(C)C |
| InChI | InChI=1S/C14H33N3/c1-7-17(8-2)12-10-15-9-11-16(6)14(5)13(3)4/h13-15H,7-12H2,1-6H3 |
| InChIKey | YYMZQFFLHQWTOI-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.44 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|