C13H30N2S — CID 107757705
N',N'-diethyl-N-[2-(3-methylbutylsulfanyl)ethyl]ethane-1,2-diamine (PubChem CID 107757705) has the molecular formula C13H30N2S and a molecular weight of 246.46 g/mol. Its IUPAC name is N',N'-diethyl-N-[2-(3-methylbutylsulfanyl)ethyl]ethane-1,2-diamine.
| Compound Name | N',N'-diethyl-N-[2-(3-methylbutylsulfanyl)ethyl]ethane-1,2-diamine |
|---|---|
| PubChem CID | 107757705 |
| Molecular Formula | C13H30N2S |
| Molecular Weight | 246.46 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | N',N'-diethyl-N-[2-(3-methylbutylsulfanyl)ethyl]ethane-1,2-diamine |
| SMILES | CCN(CC)CCNCCSCCC(C)C |
| InChI | InChI=1S/C13H30N2S/c1-5-15(6-2)10-8-14-9-12-16-11-7-13(3)4/h13-14H,5-12H2,1-4H3 |
| InChIKey | FKBOMZWWULBNRP-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.46 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|