C9H20N2 — CID 107440897
2-propan-2-yl-N'-prop-2-enylpropane-1,3-diamine (PubChem CID 107440897) has the molecular formula C9H20N2 and a molecular weight of 156.27 g/mol. Its IUPAC name is 2-propan-2-yl-N'-prop-2-enylpropane-1,3-diamine.
| Compound Name | 2-propan-2-yl-N'-prop-2-enylpropane-1,3-diamine |
|---|---|
| PubChem CID | 107440897 |
| Molecular Formula | C9H20N2 |
| Molecular Weight | 156.27 g/mol |
| Exact Mass | 156.16 |
| IUPAC Name | 2-propan-2-yl-N'-prop-2-enylpropane-1,3-diamine |
| SMILES | C=CCNCC(CN)C(C)C |
| InChI | InChI=1S/C9H20N2/c1-4-5-11-7-9(6-10)8(2)3/h4,8-9,11H,1,5-7,10H2,2-3H3 |
| InChIKey | MQQRSTDOVBAPHH-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.27 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|