C10H22N2 — CID 62557121
2-N,2-N-diethyl-1-N-prop-2-enylpropane-1,2-diamine (PubChem CID 62557121) has the molecular formula C10H22N2 and a molecular weight of 170.30 g/mol. Its IUPAC name is 2-N,2-N-diethyl-1-N-prop-2-enylpropane-1,2-diamine.
| Compound Name | 2-N,2-N-diethyl-1-N-prop-2-enylpropane-1,2-diamine |
|---|---|
| PubChem CID | 62557121 |
| Molecular Formula | C10H22N2 |
| Molecular Weight | 170.30 g/mol |
| Exact Mass | 170.18 |
| IUPAC Name | 2-N,2-N-diethyl-1-N-prop-2-enylpropane-1,2-diamine |
| SMILES | C=CCNCC(C)N(CC)CC |
| InChI | InChI=1S/C10H22N2/c1-5-8-11-9-10(4)12(6-2)7-3/h5,10-11H,1,6-9H2,2-4H3 |
| InChIKey | RIQQTILJJYNVIR-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.30 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|