C12H27N3 — CID 103189471
2-N-ethyl-1-N,1-N-dimethyl-2-N-[2-(prop-2-enylamino)ethyl]propane-1,2-diamine (PubChem CID 103189471) has the molecular formula C12H27N3 and a molecular weight of 213.37 g/mol. Its IUPAC name is 2-N-ethyl-1-N,1-N-dimethyl-2-N-[2-(prop-2-enylamino)ethyl]propane-1,2-diamine.
| Compound Name | 2-N-ethyl-1-N,1-N-dimethyl-2-N-[2-(prop-2-enylamino)ethyl]propane-1,2-diamine |
|---|---|
| PubChem CID | 103189471 |
| Molecular Formula | C12H27N3 |
| Molecular Weight | 213.37 g/mol |
| Exact Mass | 213.22 |
| IUPAC Name | 2-N-ethyl-1-N,1-N-dimethyl-2-N-[2-(prop-2-enylamino)ethyl]propane-1,2-diamine |
| SMILES | C=CCNCCN(CC)C(C)CN(C)C |
| InChI | InChI=1S/C12H27N3/c1-6-8-13-9-10-15(7-2)12(3)11-14(4)5/h6,12-13H,1,7-11H2,2-5H3 |
| InChIKey | FPRZKPDKGKHUCK-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.37 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|