C11H25N3O — CID 107441879
3-[[2-(aminomethyl)-3-methylbutyl]amino]-N,N-dimethylpropanamide (PubChem CID 107441879) has the molecular formula C11H25N3O and a molecular weight of 215.34 g/mol. Its IUPAC name is 3-[[2-(aminomethyl)-3-methylbutyl]amino]-N,N-dimethylpropanamide.
| Compound Name | 3-[[2-(aminomethyl)-3-methylbutyl]amino]-N,N-dimethylpropanamide |
|---|---|
| PubChem CID | 107441879 |
| Molecular Formula | C11H25N3O |
| Molecular Weight | 215.34 g/mol |
| Exact Mass | 215.20 |
| IUPAC Name | 3-[[2-(aminomethyl)-3-methylbutyl]amino]-N,N-dimethylpropanamide |
| SMILES | CC(C)C(CN)CNCCC(=O)N(C)C |
| InChI | InChI=1S/C11H25N3O/c1-9(2)10(7-12)8-13-6-5-11(15)14(3)4/h9-10,13H,5-8,12H2,1-4H3 |
| InChIKey | NQFRYVYEHPXVFI-UHFFFAOYSA-N |
| XLogP | 0.29 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.34 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|