C12H28N4O — CID 66430981
4-amino-3-[2-(dimethylamino)ethyl-methylamino]-N-propan-2-ylbutanamide (PubChem CID 66430981) has the molecular formula C12H28N4O and a molecular weight of 244.38 g/mol. Its IUPAC name is 4-amino-3-[2-(dimethylamino)ethyl-methylamino]-N-propan-2-ylbutanamide.
| Compound Name | 4-amino-3-[2-(dimethylamino)ethyl-methylamino]-N-propan-2-ylbutanamide |
|---|---|
| PubChem CID | 66430981 |
| Molecular Formula | C12H28N4O |
| Molecular Weight | 244.38 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | 4-amino-3-[2-(dimethylamino)ethyl-methylamino]-N-propan-2-ylbutanamide |
| SMILES | CC(C)NC(=O)CC(CN)N(C)CCN(C)C |
| InChI | InChI=1S/C12H28N4O/c1-10(2)14-12(17)8-11(9-13)16(5)7-6-15(3)4/h10-11H,6-9,13H2,1-5H3,(H,14,17) |
| InChIKey | ZFQWDSDBJPARIJ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 61.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.38 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |