amino nitrate;platinum

H2N2O3Pt — CID 174487148

IUPACamino nitrate;platinum
SMILESNO[N+](=O)[O-].[Pt]
InChIInChI=1S/H2N2O3.Pt/c1-5-2(3)4;/h1H2;
InChIKeyMGKYRXVGJMAPAA-UHFFFAOYSA-N
MW273.11 g/mol
LogP-0.93
Rot. Bonds1

About amino nitrate;platinum

amino nitrate;platinum (PubChem CID 174487148) has the molecular formula H2N2O3Pt and a molecular weight of 273.11 g/mol. Its IUPAC name is amino nitrate;platinum.

Molecular Properties

Compound Nameamino nitrate;platinum
PubChem CID174487148
Molecular FormulaH2N2O3Pt
Molecular Weight273.11 g/mol
Exact Mass272.97
IUPAC Nameamino nitrate;platinum
SMILESNO[N+](=O)[O-].[Pt]
InChIInChI=1S/H2N2O3.Pt/c1-5-2(3)4;/h1H2;
InChIKeyMGKYRXVGJMAPAA-UHFFFAOYSA-N
XLogP-0.93
TPSA78.39 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms6
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500273.11
LogP ≤ 5-0.93
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}

Analyze amino nitrate;platinum with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of amino nitrate;platinum?
The IUPAC name of amino nitrate;platinum (CID 174487148) is amino nitrate;platinum.
What is the SMILES notation for amino nitrate;platinum?
The canonical SMILES for amino nitrate;platinum is NO[N+](=O)[O-].[Pt].
What is the InChIKey of amino nitrate;platinum?
The InChIKey is MGKYRXVGJMAPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O3.Pt/c1-5-2(3)4;/h1H2;.
What are the key properties of amino nitrate;platinum?
amino nitrate;platinum has a molecular weight of 273.11 g/mol, XLogP of -0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino nitrate;platinum is sourced from PubChem (CID 174487148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).