About amino nitrate;platinum
amino nitrate;platinum (PubChem CID 174487148) has the molecular formula H2N2O3Pt
and a molecular weight of 273.11 g/mol. Its IUPAC name is amino nitrate;platinum.
Molecular Properties
| Compound Name | amino nitrate;platinum |
| PubChem CID | 174487148 |
| Molecular Formula | H2N2O3Pt |
| Molecular Weight | 273.11 g/mol |
| Exact Mass | 272.97 |
| IUPAC Name | amino nitrate;platinum |
| SMILES | NO[N+](=O)[O-].[Pt] |
| InChI | InChI=1S/H2N2O3.Pt/c1-5-2(3)4;/h1H2; |
| InChIKey | MGKYRXVGJMAPAA-UHFFFAOYSA-N |
| XLogP | -0.93 |
| TPSA | 78.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.11 |
| LogP ≤ 5 | -0.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino nitrate;platinum with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino nitrate;platinum?
The IUPAC name of amino nitrate;platinum (CID 174487148) is amino nitrate;platinum.
What is the SMILES notation for amino nitrate;platinum?
The canonical SMILES for amino nitrate;platinum is NO[N+](=O)[O-].[Pt].
What is the InChIKey of amino nitrate;platinum?
The InChIKey is MGKYRXVGJMAPAA-UHFFFAOYSA-N. The full InChI is InChI=1S/H2N2O3.Pt/c1-5-2(3)4;/h1H2;.
What are the key properties of amino nitrate;platinum?
amino nitrate;platinum has a molecular weight of 273.11 g/mol, XLogP of -0.93, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for amino nitrate;platinum is sourced from PubChem (CID 174487148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).