About CID 173313394
CID 173313394 (PubChem CID 173313394) has the molecular formula H6N4O6
and a molecular weight of 158.07 g/mol.
Molecular Properties
| Compound Name | CID 173313394 |
| PubChem CID | 173313394 |
| Molecular Formula | H6N4O6 |
| Molecular Weight | 158.07 g/mol |
| Exact Mass | 158.03 |
| IUPAC Name | — |
| SMILES | NO[N+](N)([O-])O.O=[N+]([O-])O |
| InChI | InChI=1S/H5N3O3.HNO3/c1-3(4,5)6-2;2-1(3)4/h4H,1-2H2;(H,2,3,4) |
| InChIKey | UIZVHVKXAFZITH-UHFFFAOYSA-N |
| XLogP | -1.98 |
| TPSA | 167.93 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.07 |
| LogP ≤ 5 | -1.98 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze CID 173313394 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 173313394?
The IUPAC name of CID 173313394 (CID 173313394) is not available.
What is the SMILES notation for CID 173313394?
The canonical SMILES for CID 173313394 is NO[N+](N)([O-])O.O=[N+]([O-])O.
What is the InChIKey of CID 173313394?
The InChIKey is UIZVHVKXAFZITH-UHFFFAOYSA-N. The full InChI is InChI=1S/H5N3O3.HNO3/c1-3(4,5)6-2;2-1(3)4/h4H,1-2H2;(H,2,3,4).
What are the key properties of CID 173313394?
CID 173313394 has a molecular weight of 158.07 g/mol, XLogP of -1.98, 1 rotatable bonds, 4 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 173313394 is sourced from PubChem (CID 173313394), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).