About amino nitrate;guanidine
amino nitrate;guanidine (PubChem CID 87093007) has the molecular formula CH7N5O3
and a molecular weight of 137.10 g/mol. Its IUPAC name is amino nitrate;guanidine.
Molecular Properties
| Compound Name | amino nitrate;guanidine |
| PubChem CID | 87093007 |
| Molecular Formula | CH7N5O3 |
| Molecular Weight | 137.10 g/mol |
| Exact Mass | 137.05 |
| IUPAC Name | amino nitrate;guanidine |
| SMILES | NO[N+](=O)[O-].[H]N=C(N)N |
| InChI | InChI=1S/CH5N3.H2N2O3/c2-1(3)4;1-5-2(3)4/h(H5,2,3,4);1H2 |
| InChIKey | DZOXRDSLSQVVJL-UHFFFAOYSA-N |
| XLogP | -2.09 |
| TPSA | 154.28 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.10 |
| LogP ≤ 5 | -2.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze amino nitrate;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of amino nitrate;guanidine?
The IUPAC name of amino nitrate;guanidine (CID 87093007) is amino nitrate;guanidine.
What is the SMILES notation for amino nitrate;guanidine?
The canonical SMILES for amino nitrate;guanidine is NO[N+](=O)[O-].[H]N=C(N)N.
What is the InChIKey of amino nitrate;guanidine?
The InChIKey is DZOXRDSLSQVVJL-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N3.H2N2O3/c2-1(3)4;1-5-2(3)4/h(H5,2,3,4);1H2.
What are the key properties of amino nitrate;guanidine?
amino nitrate;guanidine has a molecular weight of 137.10 g/mol, XLogP of -2.09, 1 rotatable bonds, 4 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for amino nitrate;guanidine is sourced from PubChem (CID 87093007), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).