About diamino carbonate;guanidine
diamino carbonate;guanidine (PubChem CID 87141757) has the molecular formula C2H9N5O3
and a molecular weight of 151.13 g/mol. Its IUPAC name is diamino carbonate;guanidine.
Molecular Properties
| Compound Name | diamino carbonate;guanidine |
| PubChem CID | 87141757 |
| Molecular Formula | C2H9N5O3 |
| Molecular Weight | 151.13 g/mol |
| Exact Mass | 151.07 |
| IUPAC Name | diamino carbonate;guanidine |
| SMILES | NOC(=O)ON.[H]N=C(N)N |
| InChI | InChI=1S/CH5N3.CH4N2O3/c2-1(3)4;2-5-1(4)6-3/h(H5,2,3,4);2-3H2 |
| InChIKey | MSLRNWDTTTXFGS-UHFFFAOYSA-N |
| XLogP | -2.27 |
| TPSA | 163.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.13 |
| LogP ≤ 5 | -2.27 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze diamino carbonate;guanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diamino carbonate;guanidine?
The IUPAC name of diamino carbonate;guanidine (CID 87141757) is diamino carbonate;guanidine.
What is the SMILES notation for diamino carbonate;guanidine?
The canonical SMILES for diamino carbonate;guanidine is NOC(=O)ON.[H]N=C(N)N.
What is the InChIKey of diamino carbonate;guanidine?
The InChIKey is MSLRNWDTTTXFGS-UHFFFAOYSA-N. The full InChI is InChI=1S/CH5N3.CH4N2O3/c2-1(3)4;2-5-1(4)6-3/h(H5,2,3,4);2-3H2.
What are the key properties of diamino carbonate;guanidine?
diamino carbonate;guanidine has a molecular weight of 151.13 g/mol, XLogP of -2.27, 0 rotatable bonds, 5 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for diamino carbonate;guanidine is sourced from PubChem (CID 87141757), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).